C17H13Cl2N3O2 — CID 174427868
2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 174427868) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 174427868 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-[4-[1-chloro-2-(4-chlorophenyl)ethyl]phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2ccc(C(Cl)Cc3ccc(Cl)cc3)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H13Cl2N3O2/c18-13-5-1-11(2-6-13)9-15(19)12-3-7-14(8-4-12)22-17(24)21-16(23)10-20-22/h1-8,10,15H,9H2,(H,21,23,24) |
| InChIKey | JMERMVZZDIRTMN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|