C17H36O2 — CID 174428369
2,3,4-tributylpentane-1,5-diol (PubChem CID 174428369) has the molecular formula C17H36O2 and a molecular weight of 272.47 g/mol. Its IUPAC name is 2,3,4-tributylpentane-1,5-diol.
| Compound Name | 2,3,4-tributylpentane-1,5-diol |
|---|---|
| PubChem CID | 174428369 |
| Molecular Formula | C17H36O2 |
| Molecular Weight | 272.47 g/mol |
| Exact Mass | 272.27 |
| IUPAC Name | 2,3,4-tributylpentane-1,5-diol |
| SMILES | CCCCC(CO)C(CCCC)C(CO)CCCC |
| InChI | InChI=1S/C17H36O2/c1-4-7-10-15(13-18)17(12-9-6-3)16(14-19)11-8-5-2/h15-19H,4-14H2,1-3H3 |
| InChIKey | NZFCPEJLBMHZRB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |