C15H23N — CID 174428524
2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1H-azepine (PubChem CID 174428524) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1H-azepine.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1H-azepine |
|---|---|
| PubChem CID | 174428524 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1H-azepine |
| SMILES | C1=CC=CNC=C1.C1CCC2CCCC2C1 |
| InChI | InChI=1S/C9H16.C6H7N/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-6-7-5-3-1/h8-9H,1-7H2;1-7H |
| InChIKey | YPJUNYYNMLFHDM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |