About N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate
N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate (PubChem CID 174428697) has the molecular formula C24H22ClNO3S
and a molecular weight of 439.96 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate.
Molecular Properties
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate |
| PubChem CID | 174428697 |
| Molecular Formula | C24H22ClNO3S |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate |
| SMILES | COC(=O)c1ccccc1.COc1ccc(CNc2cccc3sccc23)cc1Cl |
| InChI | InChI=1S/C16H14ClNOS.C8H8O2/c1-19-15-6-5-11(9-13(15)17)10-18-14-3-2-4-16-12(14)7-8-20-16;1-10-8(9)7-5-3-2-4-6-7/h2-9,18H,10H2,1H3;2-6H,1H3 |
| InChIKey | ZKWNCLZZSZMHSU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate?
The IUPAC name of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate (CID 174428697) is N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate.
What is the SMILES notation for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate?
The canonical SMILES for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate is COC(=O)c1ccccc1.COc1ccc(CNc2cccc3sccc23)cc1Cl.
What is the InChIKey of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate?
The InChIKey is ZKWNCLZZSZMHSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNOS.C8H8O2/c1-19-15-6-5-11(9-13(15)17)10-18-14-3-2-4-16-12(14)7-8-20-16;1-10-8(9)7-5-3-2-4-6-7/h2-9,18H,10H2,1H3;2-6H,1H3.
What are the key properties of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate?
N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate has a molecular weight of 439.96 g/mol, XLogP of 6.65, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl benzoate is sourced from PubChem (CID 174428697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).