C23H25FN2O3 — CID 174428794
3-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-2-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde (PubChem CID 174428794) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is 3-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-2-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde.
| Compound Name | 3-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-2-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174428794 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-2-(hydroxymethyl)-1,3-oxazolidine-2-carbaldehyde |
| SMILES | O=CC1(CO)OCCN1c1ccc(C2=CCN(Cc3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C23H25FN2O3/c24-22-14-20(26-12-13-29-23(26,16-27)17-28)6-7-21(22)19-8-10-25(11-9-19)15-18-4-2-1-3-5-18/h1-8,14,16,28H,9-13,15,17H2 |
| InChIKey | QPSRUQSZNIAXER-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|