C9H12N2O3S — CID 174428965
(2S)-2-acetamido-3-(5-aminothiophen-2-yl)propanoic acid (PubChem CID 174428965) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is (2S)-2-acetamido-3-(5-aminothiophen-2-yl)propanoic acid.
| Compound Name | (2S)-2-acetamido-3-(5-aminothiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 174428965 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (2S)-2-acetamido-3-(5-aminothiophen-2-yl)propanoic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccc(N)s1)C(=O)O |
| InChI | InChI=1S/C9H12N2O3S/c1-5(12)11-7(9(13)14)4-6-2-3-8(10)15-6/h2-3,7H,4,10H2,1H3,(H,11,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | VVJJMJCLDBCBEB-ZETCQYMHSA-N |
| XLogP | 0.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |