C20H27NO5S2 — CID 174429578
3-(2-amino-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl)-2-methylpropane-1-sulfonic acid;2-methylphenol (PubChem CID 174429578) has the molecular formula C20H27NO5S2 and a molecular weight of 425.57 g/mol. Its IUPAC name is 3-(2-amino-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl)-2-methylpropane-1-sulfonic acid;2-methylphenol.
| Compound Name | 3-(2-amino-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl)-2-methylpropane-1-sulfonic acid;2-methylphenol |
|---|---|
| PubChem CID | 174429578 |
| Molecular Formula | C20H27NO5S2 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-(2-amino-3,4-dihydro-2H-1,5-benzoxathiepin-3-yl)-2-methylpropane-1-sulfonic acid;2-methylphenol |
| SMILES | CC(CC1CSc2ccccc2OC1N)CS(=O)(=O)O.Cc1ccccc1O |
| InChI | InChI=1S/C13H19NO4S2.C7H8O/c1-9(8-20(15,16)17)6-10-7-19-12-5-3-2-4-11(12)18-13(10)14;1-6-4-2-3-5-7(6)8/h2-5,9-10,13H,6-8,14H2,1H3,(H,15,16,17);2-5,8H,1H3 |
| InChIKey | AAFVUIAFKRNZBG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|