C26H30N2O3SSi — CID 174430206
prop-2-enyl 2-(3-tert-butyl-2,3-diphenyl-2-silyloxyazetidin-1-yl)-1,3-thiazole-4-carboxylate (PubChem CID 174430206) has the molecular formula C26H30N2O3SSi and a molecular weight of 478.69 g/mol. Its IUPAC name is prop-2-enyl 2-(3-tert-butyl-2,3-diphenyl-2-silyloxyazetidin-1-yl)-1,3-thiazole-4-carboxylate.
| Compound Name | prop-2-enyl 2-(3-tert-butyl-2,3-diphenyl-2-silyloxyazetidin-1-yl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 174430206 |
| Molecular Formula | C26H30N2O3SSi |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | prop-2-enyl 2-(3-tert-butyl-2,3-diphenyl-2-silyloxyazetidin-1-yl)-1,3-thiazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1csc(N2CC(c3ccccc3)(C(C)(C)C)C2(O[SiH3])c2ccccc2)n1 |
| InChI | InChI=1S/C26H30N2O3SSi/c1-5-16-30-22(29)21-17-32-23(27-21)28-18-25(24(2,3)4,19-12-8-6-9-13-19)26(28,31-33)20-14-10-7-11-15-20/h5-15,17H,1,16,18H2,2-4,33H3 |
| InChIKey | VAPFNNIHIJTWCZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|