About 2-benzofuran-1,3-dione;1H-indole
2-benzofuran-1,3-dione;1H-indole (PubChem CID 174431575) has the molecular formula C16H11NO3
and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;1H-indole.
Molecular Properties
| Compound Name | 2-benzofuran-1,3-dione;1H-indole |
| PubChem CID | 174431575 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-benzofuran-1,3-dione;1H-indole |
| SMILES | O=C1OC(=O)c2ccccc21.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C8H4O3/c1-2-4-8-7(3-1)5-6-9-8;9-7-5-3-1-2-4-6(5)8(10)11-7/h1-6,9H;1-4H |
| InChIKey | CKQCIRNYXMMWKS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-benzofuran-1,3-dione;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzofuran-1,3-dione;1H-indole?
The IUPAC name of 2-benzofuran-1,3-dione;1H-indole (CID 174431575) is 2-benzofuran-1,3-dione;1H-indole.
What is the SMILES notation for 2-benzofuran-1,3-dione;1H-indole?
The canonical SMILES for 2-benzofuran-1,3-dione;1H-indole is O=C1OC(=O)c2ccccc21.c1ccc2[nH]ccc2c1.
What is the InChIKey of 2-benzofuran-1,3-dione;1H-indole?
The InChIKey is CKQCIRNYXMMWKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C8H4O3/c1-2-4-8-7(3-1)5-6-9-8;9-7-5-3-1-2-4-6(5)8(10)11-7/h1-6,9H;1-4H.
What are the key properties of 2-benzofuran-1,3-dione;1H-indole?
2-benzofuran-1,3-dione;1H-indole has a molecular weight of 265.27 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzofuran-1,3-dione;1H-indole is sourced from PubChem (CID 174431575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).