C14H21NO2S — CID 174431619
2-[(1S,4R)-1,2,7,7-tetramethyl-2-bicyclo[2.2.1]heptanyl]-2-thiocyanatoacetic acid (PubChem CID 174431619) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-[(1S,4R)-1,2,7,7-tetramethyl-2-bicyclo[2.2.1]heptanyl]-2-thiocyanatoacetic acid.
| Compound Name | 2-[(1S,4R)-1,2,7,7-tetramethyl-2-bicyclo[2.2.1]heptanyl]-2-thiocyanatoacetic acid |
|---|---|
| PubChem CID | 174431619 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-[(1S,4R)-1,2,7,7-tetramethyl-2-bicyclo[2.2.1]heptanyl]-2-thiocyanatoacetic acid |
| SMILES | CC1(C(SC#N)C(=O)O)C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C14H21NO2S/c1-12(2)9-5-6-14(12,4)13(3,7-9)10(11(16)17)18-8-15/h9-10H,5-7H2,1-4H3,(H,16,17)/t9-,10?,13?,14+/m1/s1 |
| InChIKey | RMGJGYNELNFRAK-JWVTYDKSSA-N |
| XLogP | 3.51 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|