About [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate
[2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate (PubChem CID 174431660) has the molecular formula C13H10F3NO2S
and a molecular weight of 301.29 g/mol. Its IUPAC name is [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate |
| PubChem CID | 174431660 |
| Molecular Formula | C13H10F3NO2S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate |
| SMILES | O=COCC(c1ccc(C(F)(F)F)cc1)c1cscn1 |
| InChI | InChI=1S/C13H10F3NO2S/c14-13(15,16)10-3-1-9(2-4-10)11(5-19-8-18)12-6-20-7-17-12/h1-4,6-8,11H,5H2 |
| InChIKey | UNBPGSMOQGMVEO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate?
The IUPAC name of [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate (CID 174431660) is [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate.
What is the SMILES notation for [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate?
The canonical SMILES for [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate is O=COCC(c1ccc(C(F)(F)F)cc1)c1cscn1.
What is the InChIKey of [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate?
The InChIKey is UNBPGSMOQGMVEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3NO2S/c14-13(15,16)10-3-1-9(2-4-10)11(5-19-8-18)12-6-20-7-17-12/h1-4,6-8,11H,5H2.
What are the key properties of [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate?
[2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate has a molecular weight of 301.29 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-4-yl)-2-[4-(trifluoromethyl)phenyl]ethyl] formate is sourced from PubChem (CID 174431660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).