About N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane
N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane (PubChem CID 174432061) has the molecular formula C19H27NSi
and a molecular weight of 297.52 g/mol. Its IUPAC name is N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane |
| PubChem CID | 174432061 |
| Molecular Formula | C19H27NSi |
| Molecular Weight | 297.52 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane |
| SMILES | CN(C)C.C[Si](C)(C)c1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C16H18Si.C3H9N/c1-17(2,3)16-10-6-9-14-13-8-5-4-7-12(13)11-15(14)16;1-4(2)3/h4-10H,11H2,1-3H3;1-3H3 |
| InChIKey | UICVUJOYNBXBJL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane?
The IUPAC name of N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane (CID 174432061) is N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane.
What is the SMILES notation for N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane?
The canonical SMILES for N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane is CN(C)C.C[Si](C)(C)c1cccc2c1Cc1ccccc1-2.
What is the InChIKey of N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane?
The InChIKey is UICVUJOYNBXBJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Si.C3H9N/c1-17(2,3)16-10-6-9-14-13-8-5-4-7-12(13)11-15(14)16;1-4(2)3/h4-10H,11H2,1-3H3;1-3H3.
What are the key properties of N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane?
N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane has a molecular weight of 297.52 g/mol, XLogP of 3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;9H-fluoren-1-yl(trimethyl)silane is sourced from PubChem (CID 174432061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).