About 1,3,4,5-tetramethylpyrrol-2-ol
1,3,4,5-tetramethylpyrrol-2-ol (PubChem CID 174432081) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,3,4,5-tetramethylpyrrol-2-ol.
Molecular Properties
| Compound Name | 1,3,4,5-tetramethylpyrrol-2-ol |
| PubChem CID | 174432081 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1,3,4,5-tetramethylpyrrol-2-ol |
| SMILES | Cc1c(C)c(O)n(C)c1C |
| InChI | InChI=1S/C8H13NO/c1-5-6(2)8(10)9(4)7(5)3/h10H,1-4H3 |
| InChIKey | CIJVDRIBPWVXBY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3,4,5-tetramethylpyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4,5-tetramethylpyrrol-2-ol?
The IUPAC name of 1,3,4,5-tetramethylpyrrol-2-ol (CID 174432081) is 1,3,4,5-tetramethylpyrrol-2-ol.
What is the SMILES notation for 1,3,4,5-tetramethylpyrrol-2-ol?
The canonical SMILES for 1,3,4,5-tetramethylpyrrol-2-ol is Cc1c(C)c(O)n(C)c1C.
What is the InChIKey of 1,3,4,5-tetramethylpyrrol-2-ol?
The InChIKey is CIJVDRIBPWVXBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-5-6(2)8(10)9(4)7(5)3/h10H,1-4H3.
What are the key properties of 1,3,4,5-tetramethylpyrrol-2-ol?
1,3,4,5-tetramethylpyrrol-2-ol has a molecular weight of 139.20 g/mol, XLogP of 1.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4,5-tetramethylpyrrol-2-ol is sourced from PubChem (CID 174432081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).