C9H18N2O3 — CID 174432315
2-(ethylamino)propanamide;2-methylprop-2-enoic acid (PubChem CID 174432315) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-(ethylamino)propanamide;2-methylprop-2-enoic acid.
| Compound Name | 2-(ethylamino)propanamide;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 174432315 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 2-(ethylamino)propanamide;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCNC(C)C(N)=O |
| InChI | InChI=1S/C5H12N2O.C4H6O2/c1-3-7-4(2)5(6)8;1-3(2)4(5)6/h4,7H,3H2,1-2H3,(H2,6,8);1H2,2H3,(H,5,6) |
| InChIKey | JKFUZDITJQAKDG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|