C13H29NO3Si — CID 174432379
N,2-dimethyl-3-(1,1,2-trimethoxysilinan-2-yl)propan-1-amine (PubChem CID 174432379) has the molecular formula C13H29NO3Si and a molecular weight of 275.46 g/mol. Its IUPAC name is N,2-dimethyl-3-(1,1,2-trimethoxysilinan-2-yl)propan-1-amine.
| Compound Name | N,2-dimethyl-3-(1,1,2-trimethoxysilinan-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 174432379 |
| Molecular Formula | C13H29NO3Si |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N,2-dimethyl-3-(1,1,2-trimethoxysilinan-2-yl)propan-1-amine |
| SMILES | CNCC(C)CC1(OC)CCCC[Si]1(OC)OC |
| InChI | InChI=1S/C13H29NO3Si/c1-12(11-14-2)10-13(15-3)8-6-7-9-18(13,16-4)17-5/h12,14H,6-11H2,1-5H3 |
| InChIKey | RKCCKROPGFOUGM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|