About 7-iminooctan-1-amine
7-iminooctan-1-amine (PubChem CID 174433043) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is 7-iminooctan-1-amine.
Molecular Properties
| Compound Name | 7-iminooctan-1-amine |
| PubChem CID | 174433043 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 7-iminooctan-1-amine |
| SMILES | [H]/N=C(\C)CCCCCCN |
| InChI | InChI=1S/C8H18N2/c1-8(10)6-4-2-3-5-7-9/h10H,2-7,9H2,1H3/b10-8+ |
| InChIKey | IMKAGQDJZHNKSA-CSKARUKUSA-N |
| XLogP | 1.94 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 7-iminooctan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iminooctan-1-amine?
The IUPAC name of 7-iminooctan-1-amine (CID 174433043) is 7-iminooctan-1-amine.
What is the SMILES notation for 7-iminooctan-1-amine?
The canonical SMILES for 7-iminooctan-1-amine is [H]/N=C(\C)CCCCCCN.
What is the InChIKey of 7-iminooctan-1-amine?
The InChIKey is IMKAGQDJZHNKSA-CSKARUKUSA-N. The full InChI is InChI=1S/C8H18N2/c1-8(10)6-4-2-3-5-7-9/h10H,2-7,9H2,1H3/b10-8+.
What are the key properties of 7-iminooctan-1-amine?
7-iminooctan-1-amine has a molecular weight of 142.25 g/mol, XLogP of 1.94, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iminooctan-1-amine is sourced from PubChem (CID 174433043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).