C13H25N3O2 — CID 174433432
2,2,6,6-tetramethyl-1,3-bis(2-nitrosoethyl)piperidine (PubChem CID 174433432) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1,3-bis(2-nitrosoethyl)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1,3-bis(2-nitrosoethyl)piperidine |
|---|---|
| PubChem CID | 174433432 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-1,3-bis(2-nitrosoethyl)piperidine |
| SMILES | CC1(C)CCC(CCN=O)C(C)(C)N1CCN=O |
| InChI | InChI=1S/C13H25N3O2/c1-12(2)7-5-11(6-8-14-17)13(3,4)16(12)10-9-15-18/h11H,5-10H2,1-4H3 |
| InChIKey | TZDKRFXVIHISLX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |