About 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol
4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol (PubChem CID 174433449) has the molecular formula C27H20Br2O
and a molecular weight of 520.26 g/mol. Its IUPAC name is 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol.
Molecular Properties
| Compound Name | 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol |
| PubChem CID | 174433449 |
| Molecular Formula | C27H20Br2O |
| Molecular Weight | 520.26 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol |
| SMILES | Cc1cc(C)cc(C2(c3ccc(O)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C27H20Br2O/c1-16-11-17(2)13-19(12-16)27(18-3-7-22(30)8-4-18)25-14-20(28)5-9-23(25)24-10-6-21(29)15-26(24)27/h3-15,30H,1-2H3 |
| InChIKey | WRWJRWNVCSNVRF-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.26 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol?
The IUPAC name of 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol (CID 174433449) is 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol.
What is the SMILES notation for 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol?
The canonical SMILES for 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol is Cc1cc(C)cc(C2(c3ccc(O)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)c1.
What is the InChIKey of 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol?
The InChIKey is WRWJRWNVCSNVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H20Br2O/c1-16-11-17(2)13-19(12-16)27(18-3-7-22(30)8-4-18)25-14-20(28)5-9-23(25)24-10-6-21(29)15-26(24)27/h3-15,30H,1-2H3.
What are the key properties of 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol?
4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol has a molecular weight of 520.26 g/mol, XLogP of 7.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,7-dibromo-9-(3,5-dimethylphenyl)fluoren-9-yl]phenol is sourced from PubChem (CID 174433449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).