About (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine
(5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine (PubChem CID 174433525) has the molecular formula C12H15FN3O4S-
and a molecular weight of 316.33 g/mol. Its IUPAC name is (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine |
| PubChem CID | 174433525 |
| Molecular Formula | C12H15FN3O4S- |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine |
| SMILES | NC[C@H]1CN(c2ccc(CNS(=O)[O-])c(F)c2)C(C=O)O1 |
| InChI | InChI=1S/C12H16FN3O4S/c13-11-3-9(2-1-8(11)5-15-21(18)19)16-6-10(4-14)20-12(16)7-17/h1-3,7,10,12,15H,4-6,14H2,(H,18,19)/p-1/t10-,12?/m0/s1 |
| InChIKey | FBQGVYJHFDSCIQ-NUHJPDEHSA-M |
| XLogP | -0.60 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine?
The IUPAC name of (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine (CID 174433525) is (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine.
What is the SMILES notation for (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine?
The canonical SMILES for (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine is NC[C@H]1CN(c2ccc(CNS(=O)[O-])c(F)c2)C(C=O)O1.
What is the InChIKey of (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine?
The InChIKey is FBQGVYJHFDSCIQ-NUHJPDEHSA-M. The full InChI is InChI=1S/C12H16FN3O4S/c13-11-3-9(2-1-8(11)5-15-21(18)19)16-6-10(4-14)20-12(16)7-17/h1-3,7,10,12,15H,4-6,14H2,(H,18,19)/p-1/t10-,12?/m0/s1.
What are the key properties of (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine?
(5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine has a molecular weight of 316.33 g/mol, XLogP of -0.60, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(aminomethyl)-3-[3-fluoro-4-[(sulfinatoamino)methyl]phenyl]-2-formyl-1,3-oxazolidine is sourced from PubChem (CID 174433525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).