C13H6Cl7N — CID 174433894
2,4,6-trichloro-N-[chloro-(2,4,6-trichlorophenyl)methyl]aniline (PubChem CID 174433894) has the molecular formula C13H6Cl7N and a molecular weight of 424.37 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[chloro-(2,4,6-trichlorophenyl)methyl]aniline.
| Compound Name | 2,4,6-trichloro-N-[chloro-(2,4,6-trichlorophenyl)methyl]aniline |
|---|---|
| PubChem CID | 174433894 |
| Molecular Formula | C13H6Cl7N |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 420.83 |
| IUPAC Name | 2,4,6-trichloro-N-[chloro-(2,4,6-trichlorophenyl)methyl]aniline |
| SMILES | Clc1cc(Cl)c(NC(Cl)c2c(Cl)cc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H6Cl7N/c14-5-1-7(16)11(8(17)2-5)13(20)21-12-9(18)3-6(15)4-10(12)19/h1-4,13,21H |
| InChIKey | ZOOVYCPLJAUXIY-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|