C23H23FN2O3S — CID 174435224
[4-[1-cyclohexyl-5-(4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid (PubChem CID 174435224) has the molecular formula C23H23FN2O3S and a molecular weight of 426.51 g/mol. Its IUPAC name is [4-[1-cyclohexyl-5-(4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[1-cyclohexyl-5-(4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174435224 |
| Molecular Formula | C23H23FN2O3S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | [4-[1-cyclohexyl-5-(4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid |
| SMILES | O=c1c(-c2ccc(F)cc2)c(-c2ccc(CS(=O)O)cc2)cnn1C1CCCCC1 |
| InChI | InChI=1S/C23H23FN2O3S/c24-19-12-10-18(11-13-19)22-21(17-8-6-16(7-9-17)15-30(28)29)14-25-26(23(22)27)20-4-2-1-3-5-20/h6-14,20H,1-5,15H2,(H,28,29) |
| InChIKey | HJWNXFPZVMRXSG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|