About (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride
(2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride (PubChem CID 174435575) has the molecular formula C7H18Cl2N2
and a molecular weight of 201.14 g/mol. Its IUPAC name is (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride |
| PubChem CID | 174435575 |
| Molecular Formula | C7H18Cl2N2 |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C/[C@@H](CC)CN(C)C |
| InChI | InChI=1S/C7H16N2.2ClH/c1-4-7(5-8)6-9(2)3;;/h5,7-8H,4,6H2,1-3H3;2*1H/b8-5+;;/t7-;;/m1../s1 |
| InChIKey | TXNQGMAMINPXEW-MFRAGEETSA-N |
| XLogP | 2.07 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride?
The IUPAC name of (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride (CID 174435575) is (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride.
What is the SMILES notation for (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride?
The canonical SMILES for (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride is Cl.Cl.[H]/N=C/[C@@H](CC)CN(C)C.
What is the InChIKey of (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride?
The InChIKey is TXNQGMAMINPXEW-MFRAGEETSA-N. The full InChI is InChI=1S/C7H16N2.2ClH/c1-4-7(5-8)6-9(2)3;;/h5,7-8H,4,6H2,1-3H3;2*1H/b8-5+;;/t7-;;/m1../s1.
What are the key properties of (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride?
(2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride has a molecular weight of 201.14 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methanimidoyl-N,N-dimethylbutan-1-amine;dihydrochloride is sourced from PubChem (CID 174435575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).