C20H20 — CID 174435742
7-ethyl-1,2,11,12-tetrahydrochrysene (PubChem CID 174435742) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is 7-ethyl-1,2,11,12-tetrahydrochrysene.
| Compound Name | 7-ethyl-1,2,11,12-tetrahydrochrysene |
|---|---|
| PubChem CID | 174435742 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 7-ethyl-1,2,11,12-tetrahydrochrysene |
| SMILES | CCc1cccc2c3c(ccc12)C1=C(CCC=C1)CC3 |
| InChI | InChI=1S/C20H20/c1-2-14-7-5-9-18-17(14)12-13-19-16-8-4-3-6-15(16)10-11-20(18)19/h4-5,7-9,12-13H,2-3,6,10-11H2,1H3 |
| InChIKey | FFPIVUNPEZKYSC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |