About cyclopenta-1,4-diene-1,3-dithiol
cyclopenta-1,4-diene-1,3-dithiol (PubChem CID 174436557) has the molecular formula C5H6S2
and a molecular weight of 130.24 g/mol. Its IUPAC name is cyclopenta-1,4-diene-1,3-dithiol.
Molecular Properties
| Compound Name | cyclopenta-1,4-diene-1,3-dithiol |
| PubChem CID | 174436557 |
| Molecular Formula | C5H6S2 |
| Molecular Weight | 130.24 g/mol |
| Exact Mass | 129.99 |
| IUPAC Name | cyclopenta-1,4-diene-1,3-dithiol |
| SMILES | SC1=CC(S)C=C1 |
| InChI | InChI=1S/C5H6S2/c6-4-1-2-5(7)3-4/h1-4,6-7H |
| InChIKey | LYJDBHVRQJXHTB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,4-diene-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,4-diene-1,3-dithiol?
The IUPAC name of cyclopenta-1,4-diene-1,3-dithiol (CID 174436557) is cyclopenta-1,4-diene-1,3-dithiol.
What is the SMILES notation for cyclopenta-1,4-diene-1,3-dithiol?
The canonical SMILES for cyclopenta-1,4-diene-1,3-dithiol is SC1=CC(S)C=C1.
What is the InChIKey of cyclopenta-1,4-diene-1,3-dithiol?
The InChIKey is LYJDBHVRQJXHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6S2/c6-4-1-2-5(7)3-4/h1-4,6-7H.
What are the key properties of cyclopenta-1,4-diene-1,3-dithiol?
cyclopenta-1,4-diene-1,3-dithiol has a molecular weight of 130.24 g/mol, XLogP of 1.67, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,4-diene-1,3-dithiol is sourced from PubChem (CID 174436557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).