C20H34N2O2S — CID 17443732
2,3,4,5,6-pentamethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide (PubChem CID 17443732) has the molecular formula C20H34N2O2S and a molecular weight of 366.57 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 17443732 |
| Molecular Formula | C20H34N2O2S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NC2CC(C)(C)NC(C)(C)C2)c(C)c1C |
| InChI | InChI=1S/C20H34N2O2S/c1-12-13(2)15(4)18(16(5)14(12)3)25(23,24)21-17-10-19(6,7)22-20(8,9)11-17/h17,21-22H,10-11H2,1-9H3 |
| InChIKey | SKDQGCRHOHNMLA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |