About 3-ethoxy-1,1,1-trifluorobutan-2-imine
3-ethoxy-1,1,1-trifluorobutan-2-imine (PubChem CID 174437775) has the molecular formula C6H10F3NO
and a molecular weight of 169.15 g/mol. Its IUPAC name is 3-ethoxy-1,1,1-trifluorobutan-2-imine.
Molecular Properties
| Compound Name | 3-ethoxy-1,1,1-trifluorobutan-2-imine |
| PubChem CID | 174437775 |
| Molecular Formula | C6H10F3NO |
| Molecular Weight | 169.15 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 3-ethoxy-1,1,1-trifluorobutan-2-imine |
| SMILES | [H]/N=C(\C(C)OCC)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO/c1-3-11-4(2)5(10)6(7,8)9/h4,10H,3H2,1-2H3/b10-5+ |
| InChIKey | CAOZMKWAKQDFFR-BJMVGYQFSA-N |
| XLogP | 1.99 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-1,1,1-trifluorobutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-1,1,1-trifluorobutan-2-imine?
The IUPAC name of 3-ethoxy-1,1,1-trifluorobutan-2-imine (CID 174437775) is 3-ethoxy-1,1,1-trifluorobutan-2-imine.
What is the SMILES notation for 3-ethoxy-1,1,1-trifluorobutan-2-imine?
The canonical SMILES for 3-ethoxy-1,1,1-trifluorobutan-2-imine is [H]/N=C(\C(C)OCC)C(F)(F)F.
What is the InChIKey of 3-ethoxy-1,1,1-trifluorobutan-2-imine?
The InChIKey is CAOZMKWAKQDFFR-BJMVGYQFSA-N. The full InChI is InChI=1S/C6H10F3NO/c1-3-11-4(2)5(10)6(7,8)9/h4,10H,3H2,1-2H3/b10-5+.
What are the key properties of 3-ethoxy-1,1,1-trifluorobutan-2-imine?
3-ethoxy-1,1,1-trifluorobutan-2-imine has a molecular weight of 169.15 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-1,1,1-trifluorobutan-2-imine is sourced from PubChem (CID 174437775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).