About 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride
3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride (PubChem CID 174437948) has the molecular formula C13H15Cl2OSTi
and a molecular weight of 338.10 g/mol. Its IUPAC name is 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride.
Molecular Properties
| Compound Name | 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride |
| PubChem CID | 174437948 |
| Molecular Formula | C13H15Cl2OSTi |
| Molecular Weight | 338.10 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride |
| SMILES | CCCCOc1ccsc1C1=[C-]CC=C1.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C13H15OS.2ClH.Ti/c1-2-3-9-14-12-8-10-15-13(12)11-6-4-5-7-11;;;/h4,6,8,10H,2-3,5,9H2,1H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | KKVRTYKODBRPQA-UHFFFAOYSA-L |
| XLogP | -1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.10 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride?
The IUPAC name of 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride (CID 174437948) is 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride.
What is the SMILES notation for 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride?
The canonical SMILES for 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride is CCCCOc1ccsc1C1=[C-]CC=C1.[Cl-].[Cl-].[Ti+3].
What is the InChIKey of 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride?
The InChIKey is KKVRTYKODBRPQA-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H15OS.2ClH.Ti/c1-2-3-9-14-12-8-10-15-13(12)11-6-4-5-7-11;;;/h4,6,8,10H,2-3,5,9H2,1H3;2*1H;/q-1;;;+3/p-2.
What are the key properties of 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride?
3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride has a molecular weight of 338.10 g/mol, XLogP of -1.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxy-2-cyclopenta-1,4-dien-1-ylthiophene;titanium(3+);dichloride is sourced from PubChem (CID 174437948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).