C9H12O2 — CID 174438121
bicyclo[4.1.0]hepta-1,3,5-triene;methoxymethanol (PubChem CID 174438121) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-triene;methoxymethanol.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-triene;methoxymethanol |
|---|---|
| PubChem CID | 174438121 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-triene;methoxymethanol |
| SMILES | COCO.c1ccc2c(c1)C2 |
| InChI | InChI=1S/C7H6.C2H6O2/c1-2-4-7-5-6(7)3-1;1-4-2-3/h1-4H,5H2;3H,2H2,1H3 |
| InChIKey | FKCPFGYGDUXKKR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|