About 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate
2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate (PubChem CID 174438740) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate |
| PubChem CID | 174438740 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate |
| SMILES | C=CC(=O)C(=C)C(=O)OCC(C)O |
| InChI | InChI=1S/C9H12O4/c1-4-8(11)7(3)9(12)13-5-6(2)10/h4,6,10H,1,3,5H2,2H3 |
| InChIKey | LWIIGMLGXWBWCA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate?
The IUPAC name of 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate (CID 174438740) is 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate.
What is the SMILES notation for 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate?
The canonical SMILES for 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate is C=CC(=O)C(=C)C(=O)OCC(C)O.
What is the InChIKey of 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate?
The InChIKey is LWIIGMLGXWBWCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-4-8(11)7(3)9(12)13-5-6(2)10/h4,6,10H,1,3,5H2,2H3.
What are the key properties of 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate?
2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate has a molecular weight of 184.19 g/mol, XLogP of 0.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl 2-methylidene-3-oxopent-4-enoate is sourced from PubChem (CID 174438740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).