C14H26I2N2O — CID 174439003
4-amino-3-(4-methylphenyl)butan-2-one;N,N-dimethylmethanamine;dihydroiodide (PubChem CID 174439003) has the molecular formula C14H26I2N2O and a molecular weight of 492.18 g/mol. Its IUPAC name is 4-amino-3-(4-methylphenyl)butan-2-one;N,N-dimethylmethanamine;dihydroiodide.
| Compound Name | 4-amino-3-(4-methylphenyl)butan-2-one;N,N-dimethylmethanamine;dihydroiodide |
|---|---|
| PubChem CID | 174439003 |
| Molecular Formula | C14H26I2N2O |
| Molecular Weight | 492.18 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | 4-amino-3-(4-methylphenyl)butan-2-one;N,N-dimethylmethanamine;dihydroiodide |
| SMILES | CC(=O)C(CN)c1ccc(C)cc1.CN(C)C.I.I |
| InChI | InChI=1S/C11H15NO.C3H9N.2HI/c1-8-3-5-10(6-4-8)11(7-12)9(2)13;1-4(2)3;;/h3-6,11H,7,12H2,1-2H3;1-3H3;2*1H |
| InChIKey | IGUPHDOXBXKWAK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.18 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|