About 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin
13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin (PubChem CID 174439177) has the molecular formula C24H22N4O2
and a molecular weight of 399.47 g/mol. Its IUPAC name is 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin.
Molecular Properties
| Compound Name | 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin |
| PubChem CID | 174439177 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin |
| SMILES | [2H]c1c(OC)c2cc3nc(cc4ccc(cc5nc(cc1n2CC)C=C5)[nH]4)C(OC)=C3 |
| InChI | InChI=1S/C24H22N4O2/c1-4-28-20-10-17-7-5-15(25-17)9-16-6-8-18(26-16)11-21-23(29-2)13-19(27-21)12-22(28)24(14-20)30-3/h5-14,26H,4H2,1-3H3/b15-9-,16-9-,17-10-,18-11-,19-12-,20-10-,21-11-,22-12-/i14D |
| InChIKey | ZEBYNQXUMRQJEG-XWHJKJLQSA-N |
| XLogP | 5.13 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin?
The IUPAC name of 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin (CID 174439177) is 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin.
What is the SMILES notation for 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin?
The canonical SMILES for 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin is [2H]c1c(OC)c2cc3nc(cc4ccc(cc5nc(cc1n2CC)C=C5)[nH]4)C(OC)=C3.
What is the InChIKey of 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin?
The InChIKey is ZEBYNQXUMRQJEG-XWHJKJLQSA-N. The full InChI is InChI=1S/C24H22N4O2/c1-4-28-20-10-17-7-5-15(25-17)9-16-6-8-18(26-16)11-21-23(29-2)13-19(27-21)12-22(28)24(14-20)30-3/h5-14,26H,4H2,1-3H3/b15-9-,16-9-,17-10-,18-11-,19-12-,20-10-,21-11-,22-12-/i14D.
What are the key properties of 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin?
13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin has a molecular weight of 399.47 g/mol, XLogP of 5.13, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 13-deuterio-23-ethyl-7,12-dimethoxy-21H-porphyrin is sourced from PubChem (CID 174439177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).