About hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid
hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid (PubChem CID 174439222) has the molecular formula C9H12O5PS2+
and a molecular weight of 295.30 g/mol. Its IUPAC name is hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid.
Molecular Properties
| Compound Name | hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid |
| PubChem CID | 174439222 |
| Molecular Formula | C9H12O5PS2+ |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid |
| SMILES | C=CCc1ccccc1S(=O)(=O)O.O=[P+](O)S |
| InChI | InChI=1S/C9H10O3S.HO2PS/c1-2-5-8-6-3-4-7-9(8)13(10,11)12;1-3(2)4/h2-4,6-7H,1,5H2,(H,10,11,12);(H-,1,2,4)/p+1 |
| InChIKey | CZPRJPUTBSLRAF-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid?
The IUPAC name of hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid (CID 174439222) is hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid.
What is the SMILES notation for hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid?
The canonical SMILES for hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid is C=CCc1ccccc1S(=O)(=O)O.O=[P+](O)S.
What is the InChIKey of hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid?
The InChIKey is CZPRJPUTBSLRAF-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H10O3S.HO2PS/c1-2-5-8-6-3-4-7-9(8)13(10,11)12;1-3(2)4/h2-4,6-7H,1,5H2,(H,10,11,12);(H-,1,2,4)/p+1.
What are the key properties of hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid?
hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid has a molecular weight of 295.30 g/mol, XLogP of 2.23, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-sulfanylphosphanium;2-prop-2-enylbenzenesulfonic acid is sourced from PubChem (CID 174439222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).