About 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate
5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate (PubChem CID 174439392) has the molecular formula C12H16BrNO6
and a molecular weight of 350.17 g/mol. Its IUPAC name is 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate.
Molecular Properties
| Compound Name | 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate |
| PubChem CID | 174439392 |
| Molecular Formula | C12H16BrNO6 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate |
| SMILES | CCOc1cc(Br)cc([N+](=O)[O-])c1OC.COC(C)=O |
| InChI | InChI=1S/C9H10BrNO4.C3H6O2/c1-3-15-8-5-6(10)4-7(11(12)13)9(8)14-2;1-3(4)5-2/h4-5H,3H2,1-2H3;1-2H3 |
| InChIKey | FSJFZHIFVSUEAF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate?
The IUPAC name of 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate (CID 174439392) is 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate.
What is the SMILES notation for 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate?
The canonical SMILES for 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate is CCOc1cc(Br)cc([N+](=O)[O-])c1OC.COC(C)=O.
What is the InChIKey of 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate?
The InChIKey is FSJFZHIFVSUEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO4.C3H6O2/c1-3-15-8-5-6(10)4-7(11(12)13)9(8)14-2;1-3(4)5-2/h4-5H,3H2,1-2H3;1-2H3.
What are the key properties of 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate?
5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate has a molecular weight of 350.17 g/mol, XLogP of 2.94, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-ethoxy-2-methoxy-3-nitrobenzene;methyl acetate is sourced from PubChem (CID 174439392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).