C21H27NO — CID 174439644
(E)-3-(3-methoxyphenyl)-N,N-dimethyl-1-phenylhex-1-en-2-amine (PubChem CID 174439644) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (E)-3-(3-methoxyphenyl)-N,N-dimethyl-1-phenylhex-1-en-2-amine.
| Compound Name | (E)-3-(3-methoxyphenyl)-N,N-dimethyl-1-phenylhex-1-en-2-amine |
|---|---|
| PubChem CID | 174439644 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (E)-3-(3-methoxyphenyl)-N,N-dimethyl-1-phenylhex-1-en-2-amine |
| SMILES | CCCC(/C(=C\c1ccccc1)N(C)C)c1cccc(OC)c1 |
| InChI | InChI=1S/C21H27NO/c1-5-10-20(18-13-9-14-19(16-18)23-4)21(22(2)3)15-17-11-7-6-8-12-17/h6-9,11-16,20H,5,10H2,1-4H3/b21-15+ |
| InChIKey | NGWVJHIXEZRGSB-RCCKNPSSSA-N |
| XLogP | 5.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |