About (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone
(1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone (PubChem CID 174439652) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone.
Molecular Properties
| Compound Name | (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone |
| PubChem CID | 174439652 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone |
| SMILES | CCON1CC=CCC1=C=O |
| InChI | InChI=1S/C8H11NO2/c1-2-11-9-6-4-3-5-8(9)7-10/h3-4H,2,5-6H2,1H3 |
| InChIKey | GSKDUAYWOOKNMM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone?
The IUPAC name of (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone (CID 174439652) is (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone.
What is the SMILES notation for (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone?
The canonical SMILES for (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone is CCON1CC=CCC1=C=O.
What is the InChIKey of (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone?
The InChIKey is GSKDUAYWOOKNMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-2-11-9-6-4-3-5-8(9)7-10/h3-4H,2,5-6H2,1H3.
What are the key properties of (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone?
(1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone has a molecular weight of 153.18 g/mol, XLogP of 0.92, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethoxy-2,5-dihydropyridin-6-ylidene)methanone is sourced from PubChem (CID 174439652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).