C30H37N — CID 174439668
N,N,3-trimethyl-2,2,3-triphenyl-6-propan-2-ylcyclohexan-1-amine (PubChem CID 174439668) has the molecular formula C30H37N and a molecular weight of 411.63 g/mol. Its IUPAC name is N,N,3-trimethyl-2,2,3-triphenyl-6-propan-2-ylcyclohexan-1-amine.
| Compound Name | N,N,3-trimethyl-2,2,3-triphenyl-6-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 174439668 |
| Molecular Formula | C30H37N |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | N,N,3-trimethyl-2,2,3-triphenyl-6-propan-2-ylcyclohexan-1-amine |
| SMILES | CC(C)C1CCC(C)(c2ccccc2)C(c2ccccc2)(c2ccccc2)C1N(C)C |
| InChI | InChI=1S/C30H37N/c1-23(2)27-21-22-29(3,24-15-9-6-10-16-24)30(28(27)31(4)5,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-20,23,27-28H,21-22H2,1-5H3 |
| InChIKey | IUGHBJSRIJMAQL-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |