About [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate
[4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate (PubChem CID 174439734) has the molecular formula C15H25N3O5S
and a molecular weight of 359.45 g/mol. Its IUPAC name is [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate.
Molecular Properties
| Compound Name | [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate |
| PubChem CID | 174439734 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate |
| SMILES | CC(C)c1cc(NC(=O)[C@@H](N)CO)cc(C(C)C)c1OS(N)(=O)=O |
| InChI | InChI=1S/C15H25N3O5S/c1-8(2)11-5-10(18-15(20)13(16)7-19)6-12(9(3)4)14(11)23-24(17,21)22/h5-6,8-9,13,19H,7,16H2,1-4H3,(H,18,20)(H2,17,21,22)/t13-/m0/s1 |
| InChIKey | YKSIAMXJBMTWMP-ZDUSSCGKSA-N |
| XLogP | 0.77 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate?
The IUPAC name of [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate (CID 174439734) is [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate.
What is the SMILES notation for [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate?
The canonical SMILES for [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate is CC(C)c1cc(NC(=O)[C@@H](N)CO)cc(C(C)C)c1OS(N)(=O)=O.
What is the InChIKey of [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate?
The InChIKey is YKSIAMXJBMTWMP-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H25N3O5S/c1-8(2)11-5-10(18-15(20)13(16)7-19)6-12(9(3)4)14(11)23-24(17,21)22/h5-6,8-9,13,19H,7,16H2,1-4H3,(H,18,20)(H2,17,21,22)/t13-/m0/s1.
What are the key properties of [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate?
[4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate has a molecular weight of 359.45 g/mol, XLogP of 0.77, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-2,6-di(propan-2-yl)phenyl] sulfamate is sourced from PubChem (CID 174439734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).