About N,N-dimethylmethanamine;trifluoromethyl sulfite
N,N-dimethylmethanamine;trifluoromethyl sulfite (PubChem CID 174439775) has the molecular formula C4H9F3NO3S-
and a molecular weight of 208.18 g/mol. Its IUPAC name is N,N-dimethylmethanamine;trifluoromethyl sulfite.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;trifluoromethyl sulfite |
| PubChem CID | 174439775 |
| Molecular Formula | C4H9F3NO3S- |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | N,N-dimethylmethanamine;trifluoromethyl sulfite |
| SMILES | CN(C)C.O=S([O-])OC(F)(F)F |
| InChI | InChI=1S/C3H9N.CHF3O3S/c1-4(2)3;2-1(3,4)7-8(5)6/h1-3H3;(H,5,6)/p-1 |
| InChIKey | REKMYSMZUONGHV-UHFFFAOYSA-M |
| XLogP | 0.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylmethanamine;trifluoromethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;trifluoromethyl sulfite?
The IUPAC name of N,N-dimethylmethanamine;trifluoromethyl sulfite (CID 174439775) is N,N-dimethylmethanamine;trifluoromethyl sulfite.
What is the SMILES notation for N,N-dimethylmethanamine;trifluoromethyl sulfite?
The canonical SMILES for N,N-dimethylmethanamine;trifluoromethyl sulfite is CN(C)C.O=S([O-])OC(F)(F)F.
What is the InChIKey of N,N-dimethylmethanamine;trifluoromethyl sulfite?
The InChIKey is REKMYSMZUONGHV-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9N.CHF3O3S/c1-4(2)3;2-1(3,4)7-8(5)6/h1-3H3;(H,5,6)/p-1.
What are the key properties of N,N-dimethylmethanamine;trifluoromethyl sulfite?
N,N-dimethylmethanamine;trifluoromethyl sulfite has a molecular weight of 208.18 g/mol, XLogP of 0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;trifluoromethyl sulfite is sourced from PubChem (CID 174439775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).