About 2-methoxy-4-nitrobenzoic acid;undecanoic acid
2-methoxy-4-nitrobenzoic acid;undecanoic acid (PubChem CID 174440051) has the molecular formula C19H29NO7
and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-methoxy-4-nitrobenzoic acid;undecanoic acid.
Molecular Properties
| Compound Name | 2-methoxy-4-nitrobenzoic acid;undecanoic acid |
| PubChem CID | 174440051 |
| Molecular Formula | C19H29NO7 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-methoxy-4-nitrobenzoic acid;undecanoic acid |
| SMILES | CCCCCCCCCCC(=O)O.COc1cc([N+](=O)[O-])ccc1C(=O)O |
| InChI | InChI=1S/C11H22O2.C8H7NO5/c1-2-3-4-5-6-7-8-9-10-11(12)13;1-14-7-4-5(9(12)13)2-3-6(7)8(10)11/h2-10H2,1H3,(H,12,13);2-4H,1H3,(H,10,11) |
| InChIKey | KAUQLOPTHPGGFP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-4-nitrobenzoic acid;undecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-4-nitrobenzoic acid;undecanoic acid?
The IUPAC name of 2-methoxy-4-nitrobenzoic acid;undecanoic acid (CID 174440051) is 2-methoxy-4-nitrobenzoic acid;undecanoic acid.
What is the SMILES notation for 2-methoxy-4-nitrobenzoic acid;undecanoic acid?
The canonical SMILES for 2-methoxy-4-nitrobenzoic acid;undecanoic acid is CCCCCCCCCCC(=O)O.COc1cc([N+](=O)[O-])ccc1C(=O)O.
What is the InChIKey of 2-methoxy-4-nitrobenzoic acid;undecanoic acid?
The InChIKey is KAUQLOPTHPGGFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2.C8H7NO5/c1-2-3-4-5-6-7-8-9-10-11(12)13;1-14-7-4-5(9(12)13)2-3-6(7)8(10)11/h2-10H2,1H3,(H,12,13);2-4H,1H3,(H,10,11).
What are the key properties of 2-methoxy-4-nitrobenzoic acid;undecanoic acid?
2-methoxy-4-nitrobenzoic acid;undecanoic acid has a molecular weight of 383.44 g/mol, XLogP of 4.90, 12 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-4-nitrobenzoic acid;undecanoic acid is sourced from PubChem (CID 174440051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).