About acridine;2-methylaniline
acridine;2-methylaniline (PubChem CID 174440557) has the molecular formula C20H18N2
and a molecular weight of 286.38 g/mol. Its IUPAC name is acridine;2-methylaniline.
Molecular Properties
| Compound Name | acridine;2-methylaniline |
| PubChem CID | 174440557 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | acridine;2-methylaniline |
| SMILES | Cc1ccccc1N.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.C7H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-6-4-2-3-5-7(6)8/h1-9H;2-5H,8H2,1H3 |
| InChIKey | GQJSSDGNHLQJHF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;2-methylaniline?
The IUPAC name of acridine;2-methylaniline (CID 174440557) is acridine;2-methylaniline.
What is the SMILES notation for acridine;2-methylaniline?
The canonical SMILES for acridine;2-methylaniline is Cc1ccccc1N.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;2-methylaniline?
The InChIKey is GQJSSDGNHLQJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C7H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-6-4-2-3-5-7(6)8/h1-9H;2-5H,8H2,1H3.
What are the key properties of acridine;2-methylaniline?
acridine;2-methylaniline has a molecular weight of 286.38 g/mol, XLogP of 4.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;2-methylaniline is sourced from PubChem (CID 174440557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).