About 2-tellanylethyl propanoate
2-tellanylethyl propanoate (PubChem CID 174440561) has the molecular formula C5H10O2Te
and a molecular weight of 229.73 g/mol. Its IUPAC name is 2-tellanylethyl propanoate.
Molecular Properties
| Compound Name | 2-tellanylethyl propanoate |
| PubChem CID | 174440561 |
| Molecular Formula | C5H10O2Te |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 2-tellanylethyl propanoate |
| SMILES | CCC(=O)OCC[TeH] |
| InChI | InChI=1S/C5H10O2Te/c1-2-5(6)7-3-4-8/h8H,2-4H2,1H3 |
| InChIKey | BXJROENXVRPLRK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-tellanylethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tellanylethyl propanoate?
The IUPAC name of 2-tellanylethyl propanoate (CID 174440561) is 2-tellanylethyl propanoate.
What is the SMILES notation for 2-tellanylethyl propanoate?
The canonical SMILES for 2-tellanylethyl propanoate is CCC(=O)OCC[TeH].
What is the InChIKey of 2-tellanylethyl propanoate?
The InChIKey is BXJROENXVRPLRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2Te/c1-2-5(6)7-3-4-8/h8H,2-4H2,1H3.
What are the key properties of 2-tellanylethyl propanoate?
2-tellanylethyl propanoate has a molecular weight of 229.73 g/mol, XLogP of 0.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tellanylethyl propanoate is sourced from PubChem (CID 174440561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).