About 2H-thieno[2,3-b]pyridin-4-one;hydrochloride
2H-thieno[2,3-b]pyridin-4-one;hydrochloride (PubChem CID 174440586) has the molecular formula C7H6ClNOS
and a molecular weight of 187.65 g/mol. Its IUPAC name is 2H-thieno[2,3-b]pyridin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2H-thieno[2,3-b]pyridin-4-one;hydrochloride |
| PubChem CID | 174440586 |
| Molecular Formula | C7H6ClNOS |
| Molecular Weight | 187.65 g/mol |
| Exact Mass | 186.99 |
| IUPAC Name | 2H-thieno[2,3-b]pyridin-4-one;hydrochloride |
| SMILES | Cl.O=C1C=CN=C2SCC=C12 |
| InChI | InChI=1S/C7H5NOS.ClH/c9-6-1-3-8-7-5(6)2-4-10-7;/h1-3H,4H2;1H |
| InChIKey | FLOSMMQIUHYGAM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.65 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-thieno[2,3-b]pyridin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-thieno[2,3-b]pyridin-4-one;hydrochloride?
The IUPAC name of 2H-thieno[2,3-b]pyridin-4-one;hydrochloride (CID 174440586) is 2H-thieno[2,3-b]pyridin-4-one;hydrochloride.
What is the SMILES notation for 2H-thieno[2,3-b]pyridin-4-one;hydrochloride?
The canonical SMILES for 2H-thieno[2,3-b]pyridin-4-one;hydrochloride is Cl.O=C1C=CN=C2SCC=C12.
What is the InChIKey of 2H-thieno[2,3-b]pyridin-4-one;hydrochloride?
The InChIKey is FLOSMMQIUHYGAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NOS.ClH/c9-6-1-3-8-7-5(6)2-4-10-7;/h1-3H,4H2;1H.
What are the key properties of 2H-thieno[2,3-b]pyridin-4-one;hydrochloride?
2H-thieno[2,3-b]pyridin-4-one;hydrochloride has a molecular weight of 187.65 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-thieno[2,3-b]pyridin-4-one;hydrochloride is sourced from PubChem (CID 174440586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).