About 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide
9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide (PubChem CID 174440659) has the molecular formula C20H13F3N2O
and a molecular weight of 354.33 g/mol. Its IUPAC name is 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide.
Molecular Properties
| Compound Name | 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide |
| PubChem CID | 174440659 |
| Molecular Formula | C20H13F3N2O |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1c1cccc(F)c1n2Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H13F3N2O/c21-14-8-7-11(9-16(14)23)10-25-17-6-2-4-13(20(24)26)18(17)12-3-1-5-15(22)19(12)25/h1-9H,10H2,(H2,24,26) |
| InChIKey | FGPGKWPKXHIMTD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide?
The IUPAC name of 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide (CID 174440659) is 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide.
What is the SMILES notation for 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide?
The canonical SMILES for 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide is NC(=O)c1cccc2c1c1cccc(F)c1n2Cc1ccc(F)c(F)c1.
What is the InChIKey of 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide?
The InChIKey is FGPGKWPKXHIMTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3N2O/c21-14-8-7-11(9-16(14)23)10-25-17-6-2-4-13(20(24)26)18(17)12-3-1-5-15(22)19(12)25/h1-9H,10H2,(H2,24,26).
What are the key properties of 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide?
9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide has a molecular weight of 354.33 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(3,4-difluorophenyl)methyl]-8-fluorocarbazole-4-carboxamide is sourced from PubChem (CID 174440659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).