About bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride
bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride (PubChem CID 174441438) has the molecular formula C13H21ClN2
and a molecular weight of 240.78 g/mol. Its IUPAC name is bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride |
| PubChem CID | 174441438 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride |
| SMILES | Cl.NC1CCNCC1.c1cc2cc(c1)CC2 |
| InChI | InChI=1S/C8H8.C5H12N2.ClH/c1-2-7-4-5-8(3-1)6-7;6-5-1-3-7-4-2-5;/h1-3,6H,4-5H2;5,7H,1-4,6H2;1H |
| InChIKey | SRAZXHSQNLXUNM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride?
The IUPAC name of bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride (CID 174441438) is bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride.
What is the SMILES notation for bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride?
The canonical SMILES for bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride is Cl.NC1CCNCC1.c1cc2cc(c1)CC2.
What is the InChIKey of bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride?
The InChIKey is SRAZXHSQNLXUNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C5H12N2.ClH/c1-2-7-4-5-8(3-1)6-7;6-5-1-3-7-4-2-5;/h1-3,6H,4-5H2;5,7H,1-4,6H2;1H.
What are the key properties of bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride?
bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride has a molecular weight of 240.78 g/mol, XLogP of 1.90, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.2.1]octa-1(8),2,4-triene;piperidin-4-amine;hydrochloride is sourced from PubChem (CID 174441438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).