About 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid
5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid (PubChem CID 174441860) has the molecular formula C12H18O5
and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid |
| PubChem CID | 174441860 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid |
| SMILES | CC1CCC(C(=O)O)C(CC2CO2)(C(=O)O)C1 |
| InChI | InChI=1S/C12H18O5/c1-7-2-3-9(10(13)14)12(4-7,11(15)16)5-8-6-17-8/h7-9H,2-6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | PKMDOVBYPBWUJH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid?
The IUPAC name of 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid (CID 174441860) is 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid.
What is the SMILES notation for 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid?
The canonical SMILES for 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid is CC1CCC(C(=O)O)C(CC2CO2)(C(=O)O)C1.
What is the InChIKey of 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid?
The InChIKey is PKMDOVBYPBWUJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O5/c1-7-2-3-9(10(13)14)12(4-7,11(15)16)5-8-6-17-8/h7-9H,2-6H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid?
5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid has a molecular weight of 242.27 g/mol, XLogP of 1.37, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1-(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylic acid is sourced from PubChem (CID 174441860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).