C17H16Cl2O2Zr — CID 174442019
dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene (PubChem CID 174442019) has the molecular formula C17H16Cl2O2Zr and a molecular weight of 414.44 g/mol. Its IUPAC name is dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene.
| Compound Name | dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene |
|---|---|
| PubChem CID | 174442019 |
| Molecular Formula | C17H16Cl2O2Zr |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene |
| SMILES | COc1ccc(C2C=Cc3ccccc32)c(OC)c1.Cl[Zr]Cl |
| InChI | InChI=1S/C17H16O2.2ClH.Zr/c1-18-13-8-10-16(17(11-13)19-2)15-9-7-12-5-3-4-6-14(12)15;;;/h3-11,15H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | GQNTUHGTNHFNFC-UHFFFAOYSA-L |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |