About dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene
dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene (PubChem CID 174442019) has the molecular formula C17H16Cl2O2Zr
and a molecular weight of 414.44 g/mol. Its IUPAC name is dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene.
Molecular Properties
| Compound Name | dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene |
| PubChem CID | 174442019 |
| Molecular Formula | C17H16Cl2O2Zr |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 411.96 |
| IUPAC Name | dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene |
| SMILES | COc1ccc(C2C=Cc3ccccc32)c(OC)c1.Cl[Zr]Cl |
| InChI | InChI=1S/C17H16O2.2ClH.Zr/c1-18-13-8-10-16(17(11-13)19-2)15-9-7-12-5-3-4-6-14(12)15;;;/h3-11,15H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | GQNTUHGTNHFNFC-UHFFFAOYSA-L |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene?
The IUPAC name of dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene (CID 174442019) is dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene.
What is the SMILES notation for dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene?
The canonical SMILES for dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene is COc1ccc(C2C=Cc3ccccc32)c(OC)c1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene?
The InChIKey is GQNTUHGTNHFNFC-UHFFFAOYSA-L. The full InChI is InChI=1S/C17H16O2.2ClH.Zr/c1-18-13-8-10-16(17(11-13)19-2)15-9-7-12-5-3-4-6-14(12)15;;;/h3-11,15H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene?
dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene has a molecular weight of 414.44 g/mol, XLogP of 5.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;1-(2,4-dimethoxyphenyl)-1H-indene is sourced from PubChem (CID 174442019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).