About 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium
2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium (PubChem CID 174442152) has the molecular formula C13H24O3PdSi
and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium.
Molecular Properties
| Compound Name | 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium |
| PubChem CID | 174442152 |
| Molecular Formula | C13H24O3PdSi |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium |
| SMILES | CCO[Si](OCC)(OCC)C1CC2=CCC1C2.[Pd] |
| InChI | InChI=1S/C13H24O3Si.Pd/c1-4-14-17(15-5-2,16-6-3)13-10-11-7-8-12(13)9-11;/h7,12-13H,4-6,8-10H2,1-3H3; |
| InChIKey | OAHKKLUIZKFYGK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium?
The IUPAC name of 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium (CID 174442152) is 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium.
What is the SMILES notation for 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium?
The canonical SMILES for 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium is CCO[Si](OCC)(OCC)C1CC2=CCC1C2.[Pd].
What is the InChIKey of 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium?
The InChIKey is OAHKKLUIZKFYGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3Si.Pd/c1-4-14-17(15-5-2,16-6-3)13-10-11-7-8-12(13)9-11;/h7,12-13H,4-6,8-10H2,1-3H3;.
What are the key properties of 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium?
2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium has a molecular weight of 362.84 g/mol, XLogP of 3.14, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bicyclo[2.2.1]hept-4-enyl(triethoxy)silane;palladium is sourced from PubChem (CID 174442152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).