C24H20OS4 — CID 174442178
1,1'-biphenyl;4-(4-sulfanylphenyl)sulfanyloxysulfanylbenzenethiol (PubChem CID 174442178) has the molecular formula C24H20OS4 and a molecular weight of 452.69 g/mol. Its IUPAC name is 1,1'-biphenyl;4-(4-sulfanylphenyl)sulfanyloxysulfanylbenzenethiol.
| Compound Name | 1,1'-biphenyl;4-(4-sulfanylphenyl)sulfanyloxysulfanylbenzenethiol |
|---|---|
| PubChem CID | 174442178 |
| Molecular Formula | C24H20OS4 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 1,1'-biphenyl;4-(4-sulfanylphenyl)sulfanyloxysulfanylbenzenethiol |
| SMILES | Sc1ccc(SOSc2ccc(S)cc2)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10OS4.C12H10/c14-9-1-5-11(6-2-9)16-13-17-12-7-3-10(15)4-8-12;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-8,14-15H;1-10H |
| InChIKey | DYAXUFQDYHACJI-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|