About 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one
2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one (PubChem CID 17444229) has the molecular formula C16H12F2N2O3
and a molecular weight of 318.28 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one |
| PubChem CID | 17444229 |
| Molecular Formula | C16H12F2N2O3 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one |
| SMILES | COc1ccc2cnn(-c3ccc(F)cc3F)c(=O)c2c1OC |
| InChI | InChI=1S/C16H12F2N2O3/c1-22-13-6-3-9-8-19-20(16(21)14(9)15(13)23-2)12-5-4-10(17)7-11(12)18/h3-8H,1-2H3 |
| InChIKey | GRCXFYHHFCKMTH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one?
The IUPAC name of 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one (CID 17444229) is 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one.
What is the SMILES notation for 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one?
The canonical SMILES for 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one is COc1ccc2cnn(-c3ccc(F)cc3F)c(=O)c2c1OC.
What is the InChIKey of 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one?
The InChIKey is GRCXFYHHFCKMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2N2O3/c1-22-13-6-3-9-8-19-20(16(21)14(9)15(13)23-2)12-5-4-10(17)7-11(12)18/h3-8H,1-2H3.
What are the key properties of 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one?
2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one has a molecular weight of 318.28 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)-7,8-dimethoxyphthalazin-1-one is sourced from PubChem (CID 17444229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).