About 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine
2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine (PubChem CID 174442439) has the molecular formula C20H22F2N4S
and a molecular weight of 388.49 g/mol. Its IUPAC name is 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine |
| PubChem CID | 174442439 |
| Molecular Formula | C20H22F2N4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine |
| SMILES | NC(Cc1nc2ccc(F)cc2s1)N1CCN(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22F2N4S/c21-15-3-1-14(2-4-15)13-25-7-9-26(10-8-25)19(23)12-20-24-17-6-5-16(22)11-18(17)27-20/h1-6,11,19H,7-10,12-13,23H2 |
| InChIKey | NNCRFDAQBVSGFH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine?
The IUPAC name of 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine (CID 174442439) is 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine.
What is the SMILES notation for 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine?
The canonical SMILES for 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine is NC(Cc1nc2ccc(F)cc2s1)N1CCN(Cc2ccc(F)cc2)CC1.
What is the InChIKey of 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine?
The InChIKey is NNCRFDAQBVSGFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F2N4S/c21-15-3-1-14(2-4-15)13-25-7-9-26(10-8-25)19(23)12-20-24-17-6-5-16(22)11-18(17)27-20/h1-6,11,19H,7-10,12-13,23H2.
What are the key properties of 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine?
2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine has a molecular weight of 388.49 g/mol, XLogP of 3.22, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-1,3-benzothiazol-2-yl)-1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]ethanamine is sourced from PubChem (CID 174442439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).